C15H31ClO2Si2 — CID 90436672
[(Z,2S,3R,4Z)-4-(1-chloroethylidene)-2-trimethylsilyloxyhept-5-en-3-yl]oxy-trimethylsilane (PubChem CID 90436672) has the molecular formula C15H31ClO2Si2 and a molecular weight of 335.04 g/mol. Its IUPAC name is [(Z,2S,3R,4Z)-4-(1-chloroethylidene)-2-trimethylsilyloxyhept-5-en-3-yl]oxy-trimethylsilane.
| Compound Name | [(Z,2S,3R,4Z)-4-(1-chloroethylidene)-2-trimethylsilyloxyhept-5-en-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 90436672 |
| Molecular Formula | C15H31ClO2Si2 |
| Molecular Weight | 335.04 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | [(Z,2S,3R,4Z)-4-(1-chloroethylidene)-2-trimethylsilyloxyhept-5-en-3-yl]oxy-trimethylsilane |
| SMILES | C/C=C\C(=C(/C)Cl)[C@@H](O[Si](C)(C)C)[C@H](C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H31ClO2Si2/c1-10-11-14(12(2)16)15(18-20(7,8)9)13(3)17-19(4,5)6/h10-11,13,15H,1-9H3/b11-10-,14-12-/t13-,15-/m0/s1 |
| InChIKey | GQDNJEWQNDUVTB-FDWIYIBPSA-N |
| XLogP | 5.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.04 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|