C27H30Cl2N8O4 — CID 90436748
N-[(1S,2R)-2-[[3-(2,6-dichloro-3,5-dimethoxyphenyl)-2-oxo-1-(1H-pyrazol-4-ylmethyl)-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]cyclohexyl]prop-2-enamide (PubChem CID 90436748) has the molecular formula C27H30Cl2N8O4 and a molecular weight of 601.50 g/mol. Its IUPAC name is N-[(1S,2R)-2-[[3-(2,6-dichloro-3,5-dimethoxyphenyl)-2-oxo-1-(1H-pyrazol-4-ylmethyl)-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]cyclohexyl]prop-2-enamide.
| Compound Name | N-[(1S,2R)-2-[[3-(2,6-dichloro-3,5-dimethoxyphenyl)-2-oxo-1-(1H-pyrazol-4-ylmethyl)-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 90436748 |
| Molecular Formula | C27H30Cl2N8O4 |
| Molecular Weight | 601.50 g/mol |
| Exact Mass | 600.18 |
| IUPAC Name | N-[(1S,2R)-2-[[3-(2,6-dichloro-3,5-dimethoxyphenyl)-2-oxo-1-(1H-pyrazol-4-ylmethyl)-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]cyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CCCC[C@H]1Nc1ncc2c(n1)N(Cc1cn[nH]c1)C(=O)N(c1c(Cl)c(OC)cc(OC)c1Cl)C2 |
| InChI | InChI=1S/C27H30Cl2N8O4/c1-4-21(38)33-17-7-5-6-8-18(17)34-26-30-12-16-14-36(24-22(28)19(40-2)9-20(41-3)23(24)29)27(39)37(25(16)35-26)13-15-10-31-32-11-15/h4,9-12,17-18H,1,5-8,13-14H2,2-3H3,(H,31,32)(H,33,38)(H,30,34,35)/t17-,18+/m0/s1 |
| InChIKey | DEAUCONHADZFFX-ZWKOTPCHSA-N |
| XLogP | 4.70 |
| TPSA | 137.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|