C16H22F2O2 — CID 90437314
(1S)-4-(4-butoxycyclohexen-1-yl)-2,3-difluorocyclohexa-2,4-dien-1-ol (PubChem CID 90437314) has the molecular formula C16H22F2O2 and a molecular weight of 284.35 g/mol. Its IUPAC name is (1S)-4-(4-butoxycyclohexen-1-yl)-2,3-difluorocyclohexa-2,4-dien-1-ol.
| Compound Name | (1S)-4-(4-butoxycyclohexen-1-yl)-2,3-difluorocyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 90437314 |
| Molecular Formula | C16H22F2O2 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (1S)-4-(4-butoxycyclohexen-1-yl)-2,3-difluorocyclohexa-2,4-dien-1-ol |
| SMILES | CCCCOC1CC=C(C2=CC[C@H](O)C(F)=C2F)CC1 |
| InChI | InChI=1S/C16H22F2O2/c1-2-3-10-20-12-6-4-11(5-7-12)13-8-9-14(19)16(18)15(13)17/h4,8,12,14,19H,2-3,5-7,9-10H2,1H3/t12?,14-/m0/s1 |
| InChIKey | RZCNNHFWXLZOQC-PYMCNQPYSA-N |
| XLogP | 4.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|