C36H55F3O — CID 90437415
6-[(1S,4R)-4-butoxycyclohex-2-en-1-yl]-1,2-difluoro-3-[2-[4-[(4S)-3-fluoro-4-hexylcyclohex-2-en-1-yl]cyclohexyl]ethyl]cyclohexa-1,3-diene (PubChem CID 90437415) has the molecular formula C36H55F3O and a molecular weight of 560.83 g/mol. Its IUPAC name is 6-[(1S,4R)-4-butoxycyclohex-2-en-1-yl]-1,2-difluoro-3-[2-[4-[(4S)-3-fluoro-4-hexylcyclohex-2-en-1-yl]cyclohexyl]ethyl]cyclohexa-1,3-diene.
| Compound Name | 6-[(1S,4R)-4-butoxycyclohex-2-en-1-yl]-1,2-difluoro-3-[2-[4-[(4S)-3-fluoro-4-hexylcyclohex-2-en-1-yl]cyclohexyl]ethyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 90437415 |
| Molecular Formula | C36H55F3O |
| Molecular Weight | 560.83 g/mol |
| Exact Mass | 560.42 |
| IUPAC Name | 6-[(1S,4R)-4-butoxycyclohex-2-en-1-yl]-1,2-difluoro-3-[2-[4-[(4S)-3-fluoro-4-hexylcyclohex-2-en-1-yl]cyclohexyl]ethyl]cyclohexa-1,3-diene |
| SMILES | CCCCCC[C@H]1CCC(C2CCC(CCC3=CCC([C@@H]4C=C[C@H](OCCCC)CC4)C(F)=C3F)CC2)C=C1F |
| InChI | InChI=1S/C36H55F3O/c1-3-5-7-8-9-29-16-17-31(25-34(29)37)27-13-10-26(11-14-27)12-15-30-20-23-33(36(39)35(30)38)28-18-21-32(22-19-28)40-24-6-4-2/h18,20-21,25-29,31-33H,3-17,19,22-24H2,1-2H3/t26?,27?,28-,29+,31?,32+,33?/m1/s1 |
| InChIKey | ZDQCJVZGDWTRKT-KCSKKUKUSA-N |
| XLogP | 11.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.83 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|