C32H31Cl2N7O7 — CID 90437500
tert-butyl N-[2-[[3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-[(3-nitrophenyl)methyl]-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]phenyl]carbamate (PubChem CID 90437500) has the molecular formula C32H31Cl2N7O7 and a molecular weight of 696.55 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-[(3-nitrophenyl)methyl]-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-[(3-nitrophenyl)methyl]-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 90437500 |
| Molecular Formula | C32H31Cl2N7O7 |
| Molecular Weight | 696.55 g/mol |
| Exact Mass | 695.17 |
| IUPAC Name | tert-butyl N-[2-[[3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-[(3-nitrophenyl)methyl]-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]phenyl]carbamate |
| SMILES | COc1cc(OC)c(Cl)c(N2Cc3cnc(Nc4ccccc4NC(=O)OC(C)(C)C)nc3N(Cc3cccc([N+](=O)[O-])c3)C2=O)c1Cl |
| InChI | InChI=1S/C32H31Cl2N7O7/c1-32(2,3)48-30(42)37-22-12-7-6-11-21(22)36-29-35-15-19-17-39(27-25(33)23(46-4)14-24(47-5)26(27)34)31(43)40(28(19)38-29)16-18-9-8-10-20(13-18)41(44)45/h6-15H,16-17H2,1-5H3,(H,37,42)(H,35,36,38) |
| InChIKey | AKFHPQNCJLWXPV-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 161.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.55 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|