About 6-fluoro-4,4-dimethyl-8-nitrotetrazolo[5,1-c][1,4]benzoxazine
6-fluoro-4,4-dimethyl-8-nitrotetrazolo[5,1-c][1,4]benzoxazine (PubChem CID 90437675) has the molecular formula C10H8FN5O3
and a molecular weight of 265.20 g/mol. Its IUPAC name is 6-fluoro-4,4-dimethyl-8-nitrotetrazolo[5,1-c][1,4]benzoxazine.
Molecular Properties
| Compound Name | 6-fluoro-4,4-dimethyl-8-nitrotetrazolo[5,1-c][1,4]benzoxazine |
| PubChem CID | 90437675 |
| Molecular Formula | C10H8FN5O3 |
| Molecular Weight | 265.20 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 6-fluoro-4,4-dimethyl-8-nitrotetrazolo[5,1-c][1,4]benzoxazine |
| SMILES | CC1(C)Oc2c(F)cc([N+](=O)[O-])cc2-n2nnnc21 |
| InChI | InChI=1S/C10H8FN5O3/c1-10(2)9-12-13-14-15(9)7-4-5(16(17)18)3-6(11)8(7)19-10/h3-4H,1-2H3 |
| InChIKey | HCNKORDLBUBHQD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-4,4-dimethyl-8-nitrotetrazolo[5,1-c][1,4]benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-4,4-dimethyl-8-nitrotetrazolo[5,1-c][1,4]benzoxazine?
The IUPAC name of 6-fluoro-4,4-dimethyl-8-nitrotetrazolo[5,1-c][1,4]benzoxazine (CID 90437675) is 6-fluoro-4,4-dimethyl-8-nitrotetrazolo[5,1-c][1,4]benzoxazine.
What is the SMILES notation for 6-fluoro-4,4-dimethyl-8-nitrotetrazolo[5,1-c][1,4]benzoxazine?
The canonical SMILES for 6-fluoro-4,4-dimethyl-8-nitrotetrazolo[5,1-c][1,4]benzoxazine is CC1(C)Oc2c(F)cc([N+](=O)[O-])cc2-n2nnnc21.
What is the InChIKey of 6-fluoro-4,4-dimethyl-8-nitrotetrazolo[5,1-c][1,4]benzoxazine?
The InChIKey is HCNKORDLBUBHQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8FN5O3/c1-10(2)9-12-13-14-15(9)7-4-5(16(17)18)3-6(11)8(7)19-10/h3-4H,1-2H3.
What are the key properties of 6-fluoro-4,4-dimethyl-8-nitrotetrazolo[5,1-c][1,4]benzoxazine?
6-fluoro-4,4-dimethyl-8-nitrotetrazolo[5,1-c][1,4]benzoxazine has a molecular weight of 265.20 g/mol, XLogP of 1.34, 1 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-4,4-dimethyl-8-nitrotetrazolo[5,1-c][1,4]benzoxazine is sourced from PubChem (CID 90437675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).