About 4-amino-3-chloro-6-(2,3-dihydro-1-benzofuran-6-yl)-5-fluoropyridine-2-carboxylic acid
4-amino-3-chloro-6-(2,3-dihydro-1-benzofuran-6-yl)-5-fluoropyridine-2-carboxylic acid (PubChem CID 90437830) has the molecular formula C14H10ClFN2O3
and a molecular weight of 308.70 g/mol. Its IUPAC name is 4-amino-3-chloro-6-(2,3-dihydro-1-benzofuran-6-yl)-5-fluoropyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-amino-3-chloro-6-(2,3-dihydro-1-benzofuran-6-yl)-5-fluoropyridine-2-carboxylic acid |
| PubChem CID | 90437830 |
| Molecular Formula | C14H10ClFN2O3 |
| Molecular Weight | 308.70 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 4-amino-3-chloro-6-(2,3-dihydro-1-benzofuran-6-yl)-5-fluoropyridine-2-carboxylic acid |
| SMILES | Nc1c(F)c(-c2ccc3c(c2)OCC3)nc(C(=O)O)c1Cl |
| InChI | InChI=1S/C14H10ClFN2O3/c15-9-11(17)10(16)12(18-13(9)14(19)20)7-2-1-6-3-4-21-8(6)5-7/h1-2,5H,3-4H2,(H2,17,18)(H,19,20) |
| InChIKey | WHBLZHWHWNIHHP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.70 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-3-chloro-6-(2,3-dihydro-1-benzofuran-6-yl)-5-fluoropyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-chloro-6-(2,3-dihydro-1-benzofuran-6-yl)-5-fluoropyridine-2-carboxylic acid?
The IUPAC name of 4-amino-3-chloro-6-(2,3-dihydro-1-benzofuran-6-yl)-5-fluoropyridine-2-carboxylic acid (CID 90437830) is 4-amino-3-chloro-6-(2,3-dihydro-1-benzofuran-6-yl)-5-fluoropyridine-2-carboxylic acid.
What is the SMILES notation for 4-amino-3-chloro-6-(2,3-dihydro-1-benzofuran-6-yl)-5-fluoropyridine-2-carboxylic acid?
The canonical SMILES for 4-amino-3-chloro-6-(2,3-dihydro-1-benzofuran-6-yl)-5-fluoropyridine-2-carboxylic acid is Nc1c(F)c(-c2ccc3c(c2)OCC3)nc(C(=O)O)c1Cl.
What is the InChIKey of 4-amino-3-chloro-6-(2,3-dihydro-1-benzofuran-6-yl)-5-fluoropyridine-2-carboxylic acid?
The InChIKey is WHBLZHWHWNIHHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10ClFN2O3/c15-9-11(17)10(16)12(18-13(9)14(19)20)7-2-1-6-3-4-21-8(6)5-7/h1-2,5H,3-4H2,(H2,17,18)(H,19,20).
What are the key properties of 4-amino-3-chloro-6-(2,3-dihydro-1-benzofuran-6-yl)-5-fluoropyridine-2-carboxylic acid?
4-amino-3-chloro-6-(2,3-dihydro-1-benzofuran-6-yl)-5-fluoropyridine-2-carboxylic acid has a molecular weight of 308.70 g/mol, XLogP of 2.76, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-chloro-6-(2,3-dihydro-1-benzofuran-6-yl)-5-fluoropyridine-2-carboxylic acid is sourced from PubChem (CID 90437830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).