C19H25N3O — CID 90437895
N-[4-[(2E,4E)-5-ethoxyhepta-2,4,6-trienyl]phenyl]-1-methyl-4,5-dihydroimidazol-2-amine (PubChem CID 90437895) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is N-[4-[(2E,4E)-5-ethoxyhepta-2,4,6-trienyl]phenyl]-1-methyl-4,5-dihydroimidazol-2-amine.
| Compound Name | N-[4-[(2E,4E)-5-ethoxyhepta-2,4,6-trienyl]phenyl]-1-methyl-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 90437895 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | N-[4-[(2E,4E)-5-ethoxyhepta-2,4,6-trienyl]phenyl]-1-methyl-4,5-dihydroimidazol-2-amine |
| SMILES | C=C/C(=C\C=C\Cc1ccc(NC2=NCCN2C)cc1)OCC |
| InChI | InChI=1S/C19H25N3O/c1-4-18(23-5-2)9-7-6-8-16-10-12-17(13-11-16)21-19-20-14-15-22(19)3/h4,6-7,9-13H,1,5,8,14-15H2,2-3H3,(H,20,21)/b7-6+,18-9+ |
| InChIKey | UPAKCNQDLLPTMQ-VNDALFFJSA-N |
| XLogP | 3.61 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|