C17H32O3Si — CID 90437909
(1S,3aS,4S,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-ethyl-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 90437909) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is (1S,3aS,4S,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-ethyl-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | (1S,3aS,4S,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-ethyl-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 90437909 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | (1S,3aS,4S,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-ethyl-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | CC[C@@H]1C(=O)C[C@H]2C1C[C@@H](O)[C@@H]2CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O3Si/c1-7-11-12-8-16(19)14(13(12)9-15(11)18)10-20-21(5,6)17(2,3)4/h11-14,16,19H,7-10H2,1-6H3/t11-,12?,13-,14+,16+/m0/s1 |
| InChIKey | UUPIQYCJRHZTSK-QGMOTEBLSA-N |
| XLogP | 3.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|