About 3-methylhexane-1,4,5-triol
3-methylhexane-1,4,5-triol (PubChem CID 90439662) has the molecular formula C7H16O3
and a molecular weight of 148.20 g/mol. Its IUPAC name is 3-methylhexane-1,4,5-triol.
Molecular Properties
| Compound Name | 3-methylhexane-1,4,5-triol |
| PubChem CID | 90439662 |
| Molecular Formula | C7H16O3 |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | 3-methylhexane-1,4,5-triol |
| SMILES | CC(O)C(O)C(C)CCO |
| InChI | InChI=1S/C7H16O3/c1-5(3-4-8)7(10)6(2)9/h5-10H,3-4H2,1-2H3 |
| InChIKey | PJNLTNYZVKJWGJ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methylhexane-1,4,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylhexane-1,4,5-triol?
The IUPAC name of 3-methylhexane-1,4,5-triol (CID 90439662) is 3-methylhexane-1,4,5-triol.
What is the SMILES notation for 3-methylhexane-1,4,5-triol?
The canonical SMILES for 3-methylhexane-1,4,5-triol is CC(O)C(O)C(C)CCO.
What is the InChIKey of 3-methylhexane-1,4,5-triol?
The InChIKey is PJNLTNYZVKJWGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O3/c1-5(3-4-8)7(10)6(2)9/h5-10H,3-4H2,1-2H3.
What are the key properties of 3-methylhexane-1,4,5-triol?
3-methylhexane-1,4,5-triol has a molecular weight of 148.20 g/mol, XLogP of -0.25, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylhexane-1,4,5-triol is sourced from PubChem (CID 90439662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).