About 2,3-dimethyldodecane-2,3-diol
2,3-dimethyldodecane-2,3-diol (PubChem CID 90439859) has the molecular formula C14H30O2
and a molecular weight of 230.39 g/mol. Its IUPAC name is 2,3-dimethyldodecane-2,3-diol.
Molecular Properties
| Compound Name | 2,3-dimethyldodecane-2,3-diol |
| PubChem CID | 90439859 |
| Molecular Formula | C14H30O2 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.22 |
| IUPAC Name | 2,3-dimethyldodecane-2,3-diol |
| SMILES | CCCCCCCCCC(C)(O)C(C)(C)O |
| InChI | InChI=1S/C14H30O2/c1-5-6-7-8-9-10-11-12-14(4,16)13(2,3)15/h15-16H,5-12H2,1-4H3 |
| InChIKey | KUOWHLIPQVNXSP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyldodecane-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyldodecane-2,3-diol?
The IUPAC name of 2,3-dimethyldodecane-2,3-diol (CID 90439859) is 2,3-dimethyldodecane-2,3-diol.
What is the SMILES notation for 2,3-dimethyldodecane-2,3-diol?
The canonical SMILES for 2,3-dimethyldodecane-2,3-diol is CCCCCCCCCC(C)(O)C(C)(C)O.
What is the InChIKey of 2,3-dimethyldodecane-2,3-diol?
The InChIKey is KUOWHLIPQVNXSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O2/c1-5-6-7-8-9-10-11-12-14(4,16)13(2,3)15/h15-16H,5-12H2,1-4H3.
What are the key properties of 2,3-dimethyldodecane-2,3-diol?
2,3-dimethyldodecane-2,3-diol has a molecular weight of 230.39 g/mol, XLogP of 3.65, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyldodecane-2,3-diol is sourced from PubChem (CID 90439859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).