About 8a-methyl-2,3,5,6,7,8-hexahydro-1H-indolizin-7-amine
8a-methyl-2,3,5,6,7,8-hexahydro-1H-indolizin-7-amine (PubChem CID 90440112) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 8a-methyl-2,3,5,6,7,8-hexahydro-1H-indolizin-7-amine.
Analyze 8a-methyl-2,3,5,6,7,8-hexahydro-1H-indolizin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8a-methyl-2,3,5,6,7,8-hexahydro-1H-indolizin-7-amine?
The IUPAC name of 8a-methyl-2,3,5,6,7,8-hexahydro-1H-indolizin-7-amine (CID 90440112) is 8a-methyl-2,3,5,6,7,8-hexahydro-1H-indolizin-7-amine.
What is the SMILES notation for 8a-methyl-2,3,5,6,7,8-hexahydro-1H-indolizin-7-amine?
The canonical SMILES for 8a-methyl-2,3,5,6,7,8-hexahydro-1H-indolizin-7-amine is CC12CCCN1CCC(N)C2.
What is the InChIKey of 8a-methyl-2,3,5,6,7,8-hexahydro-1H-indolizin-7-amine?
The InChIKey is FDLSXTWFYNCPRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2/c1-9-4-2-5-11(9)6-3-8(10)7-9/h8H,2-7,10H2,1H3.
What are the key properties of 8a-methyl-2,3,5,6,7,8-hexahydro-1H-indolizin-7-amine?
8a-methyl-2,3,5,6,7,8-hexahydro-1H-indolizin-7-amine has a molecular weight of 154.26 g/mol, XLogP of 0.96, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8a-methyl-2,3,5,6,7,8-hexahydro-1H-indolizin-7-amine is sourced from PubChem (CID 90440112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).