C9H16N2 — CID 90440151
8a-methyl-1,2,3,5,6,8-hexahydroindolizin-7-imine (PubChem CID 90440151) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 8a-methyl-1,2,3,5,6,8-hexahydroindolizin-7-imine.
| Compound Name | 8a-methyl-1,2,3,5,6,8-hexahydroindolizin-7-imine |
|---|---|
| PubChem CID | 90440151 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 8a-methyl-1,2,3,5,6,8-hexahydroindolizin-7-imine |
| SMILES | [H]/N=C1\CCN2CCCC2(C)C1 |
| InChI | InChI=1S/C9H16N2/c1-9-4-2-5-11(9)6-3-8(10)7-9/h10H,2-7H2,1H3/b10-8+ |
| InChIKey | IVVUYWHLLVEXMR-CSKARUKUSA-N |
| XLogP | 1.65 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|