About (Z)-1-(7-tert-butyl-2,7-diazaspiro[3.4]octan-2-yl)-4-(dimethylamino)but-2-en-1-one
(Z)-1-(7-tert-butyl-2,7-diazaspiro[3.4]octan-2-yl)-4-(dimethylamino)but-2-en-1-one (PubChem CID 90440156) has the molecular formula C16H29N3O
and a molecular weight of 279.43 g/mol. Its IUPAC name is (Z)-1-(7-tert-butyl-2,7-diazaspiro[3.4]octan-2-yl)-4-(dimethylamino)but-2-en-1-one.
Molecular Properties
| Compound Name | (Z)-1-(7-tert-butyl-2,7-diazaspiro[3.4]octan-2-yl)-4-(dimethylamino)but-2-en-1-one |
| PubChem CID | 90440156 |
| Molecular Formula | C16H29N3O |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.23 |
| IUPAC Name | (Z)-1-(7-tert-butyl-2,7-diazaspiro[3.4]octan-2-yl)-4-(dimethylamino)but-2-en-1-one |
| SMILES | CN(C)C/C=C\C(=O)N1CC2(CCN(C(C)(C)C)C2)C1 |
| InChI | InChI=1S/C16H29N3O/c1-15(2,3)19-10-8-16(13-19)11-18(12-16)14(20)7-6-9-17(4)5/h6-7H,8-13H2,1-5H3/b7-6- |
| InChIKey | JMRSRAAWCWKBDD-SREVYHEPSA-N |
| XLogP | 1.44 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-(7-tert-butyl-2,7-diazaspiro[3.4]octan-2-yl)-4-(dimethylamino)but-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(7-tert-butyl-2,7-diazaspiro[3.4]octan-2-yl)-4-(dimethylamino)but-2-en-1-one?
The IUPAC name of (Z)-1-(7-tert-butyl-2,7-diazaspiro[3.4]octan-2-yl)-4-(dimethylamino)but-2-en-1-one (CID 90440156) is (Z)-1-(7-tert-butyl-2,7-diazaspiro[3.4]octan-2-yl)-4-(dimethylamino)but-2-en-1-one.
What is the SMILES notation for (Z)-1-(7-tert-butyl-2,7-diazaspiro[3.4]octan-2-yl)-4-(dimethylamino)but-2-en-1-one?
The canonical SMILES for (Z)-1-(7-tert-butyl-2,7-diazaspiro[3.4]octan-2-yl)-4-(dimethylamino)but-2-en-1-one is CN(C)C/C=C\C(=O)N1CC2(CCN(C(C)(C)C)C2)C1.
What is the InChIKey of (Z)-1-(7-tert-butyl-2,7-diazaspiro[3.4]octan-2-yl)-4-(dimethylamino)but-2-en-1-one?
The InChIKey is JMRSRAAWCWKBDD-SREVYHEPSA-N. The full InChI is InChI=1S/C16H29N3O/c1-15(2,3)19-10-8-16(13-19)11-18(12-16)14(20)7-6-9-17(4)5/h6-7H,8-13H2,1-5H3/b7-6-.
What are the key properties of (Z)-1-(7-tert-butyl-2,7-diazaspiro[3.4]octan-2-yl)-4-(dimethylamino)but-2-en-1-one?
(Z)-1-(7-tert-butyl-2,7-diazaspiro[3.4]octan-2-yl)-4-(dimethylamino)but-2-en-1-one has a molecular weight of 279.43 g/mol, XLogP of 1.44, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(7-tert-butyl-2,7-diazaspiro[3.4]octan-2-yl)-4-(dimethylamino)but-2-en-1-one is sourced from PubChem (CID 90440156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).