About 1-ethyl-3,4,6,7-tetrahydropyrrolo[1,2-a]pyrazine
1-ethyl-3,4,6,7-tetrahydropyrrolo[1,2-a]pyrazine (PubChem CID 90440727) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 1-ethyl-3,4,6,7-tetrahydropyrrolo[1,2-a]pyrazine.
Analyze 1-ethyl-3,4,6,7-tetrahydropyrrolo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3,4,6,7-tetrahydropyrrolo[1,2-a]pyrazine?
The IUPAC name of 1-ethyl-3,4,6,7-tetrahydropyrrolo[1,2-a]pyrazine (CID 90440727) is 1-ethyl-3,4,6,7-tetrahydropyrrolo[1,2-a]pyrazine.
What is the SMILES notation for 1-ethyl-3,4,6,7-tetrahydropyrrolo[1,2-a]pyrazine?
The canonical SMILES for 1-ethyl-3,4,6,7-tetrahydropyrrolo[1,2-a]pyrazine is CCC1=NCCN2CCC=C12.
What is the InChIKey of 1-ethyl-3,4,6,7-tetrahydropyrrolo[1,2-a]pyrazine?
The InChIKey is UHNADBYPXQNMJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-2-8-9-4-3-6-11(9)7-5-10-8/h4H,2-3,5-7H2,1H3.
What are the key properties of 1-ethyl-3,4,6,7-tetrahydropyrrolo[1,2-a]pyrazine?
1-ethyl-3,4,6,7-tetrahydropyrrolo[1,2-a]pyrazine has a molecular weight of 150.22 g/mol, XLogP of 1.44, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3,4,6,7-tetrahydropyrrolo[1,2-a]pyrazine is sourced from PubChem (CID 90440727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).