About 6-butan-2-yloxyhexyl (E)-5-hydroxy-5-methyl-4-oxohept-2-enoate
6-butan-2-yloxyhexyl (E)-5-hydroxy-5-methyl-4-oxohept-2-enoate (PubChem CID 90440743) has the molecular formula C18H32O5
and a molecular weight of 328.45 g/mol. Its IUPAC name is 6-butan-2-yloxyhexyl (E)-5-hydroxy-5-methyl-4-oxohept-2-enoate.
Molecular Properties
| Compound Name | 6-butan-2-yloxyhexyl (E)-5-hydroxy-5-methyl-4-oxohept-2-enoate |
| PubChem CID | 90440743 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 6-butan-2-yloxyhexyl (E)-5-hydroxy-5-methyl-4-oxohept-2-enoate |
| SMILES | CCC(C)OCCCCCCOC(=O)/C=C/C(=O)C(C)(O)CC |
| InChI | InChI=1S/C18H32O5/c1-5-15(3)22-13-9-7-8-10-14-23-17(20)12-11-16(19)18(4,21)6-2/h11-12,15,21H,5-10,13-14H2,1-4H3/b12-11+ |
| InChIKey | ZYDWSPQJQLMYFJ-VAWYXSNFSA-N |
| XLogP | 3.19 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-butan-2-yloxyhexyl (E)-5-hydroxy-5-methyl-4-oxohept-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butan-2-yloxyhexyl (E)-5-hydroxy-5-methyl-4-oxohept-2-enoate?
The IUPAC name of 6-butan-2-yloxyhexyl (E)-5-hydroxy-5-methyl-4-oxohept-2-enoate (CID 90440743) is 6-butan-2-yloxyhexyl (E)-5-hydroxy-5-methyl-4-oxohept-2-enoate.
What is the SMILES notation for 6-butan-2-yloxyhexyl (E)-5-hydroxy-5-methyl-4-oxohept-2-enoate?
The canonical SMILES for 6-butan-2-yloxyhexyl (E)-5-hydroxy-5-methyl-4-oxohept-2-enoate is CCC(C)OCCCCCCOC(=O)/C=C/C(=O)C(C)(O)CC.
What is the InChIKey of 6-butan-2-yloxyhexyl (E)-5-hydroxy-5-methyl-4-oxohept-2-enoate?
The InChIKey is ZYDWSPQJQLMYFJ-VAWYXSNFSA-N. The full InChI is InChI=1S/C18H32O5/c1-5-15(3)22-13-9-7-8-10-14-23-17(20)12-11-16(19)18(4,21)6-2/h11-12,15,21H,5-10,13-14H2,1-4H3/b12-11+.
What are the key properties of 6-butan-2-yloxyhexyl (E)-5-hydroxy-5-methyl-4-oxohept-2-enoate?
6-butan-2-yloxyhexyl (E)-5-hydroxy-5-methyl-4-oxohept-2-enoate has a molecular weight of 328.45 g/mol, XLogP of 3.19, 13 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butan-2-yloxyhexyl (E)-5-hydroxy-5-methyl-4-oxohept-2-enoate is sourced from PubChem (CID 90440743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).