C25H25ClF3N5O5 — CID 90441025
1-butyl-7-[(5-chloro-2-pyridinyl)methyl]-3-methyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione (PubChem CID 90441025) has the molecular formula C25H25ClF3N5O5 and a molecular weight of 567.95 g/mol. Its IUPAC name is 1-butyl-7-[(5-chloro-2-pyridinyl)methyl]-3-methyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione.
| Compound Name | 1-butyl-7-[(5-chloro-2-pyridinyl)methyl]-3-methyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione |
|---|---|
| PubChem CID | 90441025 |
| Molecular Formula | C25H25ClF3N5O5 |
| Molecular Weight | 567.95 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | 1-butyl-7-[(5-chloro-2-pyridinyl)methyl]-3-methyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione |
| SMILES | CCCCn1c(=O)c2c(nc(OCCOc3cccc(OC(F)(F)F)c3)n2Cc2ccc(Cl)cn2)n(C)c1=O |
| InChI | InChI=1S/C25H25ClF3N5O5/c1-3-4-10-33-22(35)20-21(32(2)24(33)36)31-23(34(20)15-17-9-8-16(26)14-30-17)38-12-11-37-18-6-5-7-19(13-18)39-25(27,28)29/h5-9,13-14H,3-4,10-12,15H2,1-2H3 |
| InChIKey | XWSSTXILXDVUMK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 102.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.95 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|