C25H32N4O2 — CID 90441089
(1S,2S,6R,16R)-16-(azidomethyl)-5-(cyclopropylmethyl)-15-methoxy-11-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene (PubChem CID 90441089) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is (1S,2S,6R,16R)-16-(azidomethyl)-5-(cyclopropylmethyl)-15-methoxy-11-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene.
| Compound Name | (1S,2S,6R,16R)-16-(azidomethyl)-5-(cyclopropylmethyl)-15-methoxy-11-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene |
|---|---|
| PubChem CID | 90441089 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | (1S,2S,6R,16R)-16-(azidomethyl)-5-(cyclopropylmethyl)-15-methoxy-11-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene |
| SMILES | COC12CC[C@@]3(CC1CN=[N+]=[N-])[C@H]1Cc4ccc(C)c5c4[C@@]3(CCN1CC1CC1)C2O5 |
| InChI | InChI=1S/C25H32N4O2/c1-15-3-6-17-11-19-23-7-8-25(30-2,18(12-23)13-27-28-26)22-24(23,20(17)21(15)31-22)9-10-29(19)14-16-4-5-16/h3,6,16,18-19,22H,4-5,7-14H2,1-2H3/t18?,19-,22?,23-,24+,25?/m1/s1 |
| InChIKey | ILRXFRWRZXWYEJ-CRTJUPNYSA-N |
| XLogP | 4.53 |
| TPSA | 70.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|