About 2-[4-[(2-tert-butyl-5-fluoro-1-benzofuran-7-yl)methoxy]-2,3-dimethylphenyl]ethyl formate
2-[4-[(2-tert-butyl-5-fluoro-1-benzofuran-7-yl)methoxy]-2,3-dimethylphenyl]ethyl formate (PubChem CID 90441245) has the molecular formula C24H27FO4
and a molecular weight of 398.47 g/mol. Its IUPAC name is 2-[4-[(2-tert-butyl-5-fluoro-1-benzofuran-7-yl)methoxy]-2,3-dimethylphenyl]ethyl formate.
Molecular Properties
| Compound Name | 2-[4-[(2-tert-butyl-5-fluoro-1-benzofuran-7-yl)methoxy]-2,3-dimethylphenyl]ethyl formate |
| PubChem CID | 90441245 |
| Molecular Formula | C24H27FO4 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 2-[4-[(2-tert-butyl-5-fluoro-1-benzofuran-7-yl)methoxy]-2,3-dimethylphenyl]ethyl formate |
| SMILES | Cc1c(CCOC=O)ccc(OCc2cc(F)cc3cc(C(C)(C)C)oc23)c1C |
| InChI | InChI=1S/C24H27FO4/c1-15-16(2)21(7-6-17(15)8-9-27-14-26)28-13-19-11-20(25)10-18-12-22(24(3,4)5)29-23(18)19/h6-7,10-12,14H,8-9,13H2,1-5H3 |
| InChIKey | VAEKCUXBRKSITI-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(2-tert-butyl-5-fluoro-1-benzofuran-7-yl)methoxy]-2,3-dimethylphenyl]ethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(2-tert-butyl-5-fluoro-1-benzofuran-7-yl)methoxy]-2,3-dimethylphenyl]ethyl formate?
The IUPAC name of 2-[4-[(2-tert-butyl-5-fluoro-1-benzofuran-7-yl)methoxy]-2,3-dimethylphenyl]ethyl formate (CID 90441245) is 2-[4-[(2-tert-butyl-5-fluoro-1-benzofuran-7-yl)methoxy]-2,3-dimethylphenyl]ethyl formate.
What is the SMILES notation for 2-[4-[(2-tert-butyl-5-fluoro-1-benzofuran-7-yl)methoxy]-2,3-dimethylphenyl]ethyl formate?
The canonical SMILES for 2-[4-[(2-tert-butyl-5-fluoro-1-benzofuran-7-yl)methoxy]-2,3-dimethylphenyl]ethyl formate is Cc1c(CCOC=O)ccc(OCc2cc(F)cc3cc(C(C)(C)C)oc23)c1C.
What is the InChIKey of 2-[4-[(2-tert-butyl-5-fluoro-1-benzofuran-7-yl)methoxy]-2,3-dimethylphenyl]ethyl formate?
The InChIKey is VAEKCUXBRKSITI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27FO4/c1-15-16(2)21(7-6-17(15)8-9-27-14-26)28-13-19-11-20(25)10-18-12-22(24(3,4)5)29-23(18)19/h6-7,10-12,14H,8-9,13H2,1-5H3.
What are the key properties of 2-[4-[(2-tert-butyl-5-fluoro-1-benzofuran-7-yl)methoxy]-2,3-dimethylphenyl]ethyl formate?
2-[4-[(2-tert-butyl-5-fluoro-1-benzofuran-7-yl)methoxy]-2,3-dimethylphenyl]ethyl formate has a molecular weight of 398.47 g/mol, XLogP of 5.78, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(2-tert-butyl-5-fluoro-1-benzofuran-7-yl)methoxy]-2,3-dimethylphenyl]ethyl formate is sourced from PubChem (CID 90441245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).