C24H27F3N2O3S3 — CID 90441282
[1-[4-[2-(dimethylamino)ethyldisulfanyl]phenyl]-2,2,2-trifluoroethyl] 5-(dimethylamino)naphthalene-1-sulfonate (PubChem CID 90441282) has the molecular formula C24H27F3N2O3S3 and a molecular weight of 544.69 g/mol. Its IUPAC name is [1-[4-[2-(dimethylamino)ethyldisulfanyl]phenyl]-2,2,2-trifluoroethyl] 5-(dimethylamino)naphthalene-1-sulfonate.
| Compound Name | [1-[4-[2-(dimethylamino)ethyldisulfanyl]phenyl]-2,2,2-trifluoroethyl] 5-(dimethylamino)naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 90441282 |
| Molecular Formula | C24H27F3N2O3S3 |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | [1-[4-[2-(dimethylamino)ethyldisulfanyl]phenyl]-2,2,2-trifluoroethyl] 5-(dimethylamino)naphthalene-1-sulfonate |
| SMILES | CN(C)CCSSc1ccc(C(OS(=O)(=O)c2cccc3c(N(C)C)cccc23)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H27F3N2O3S3/c1-28(2)15-16-33-34-18-13-11-17(12-14-18)23(24(25,26)27)32-35(30,31)22-10-6-7-19-20(22)8-5-9-21(19)29(3)4/h5-14,23H,15-16H2,1-4H3 |
| InChIKey | YMFCOWDKWSLOAY-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|