C13H9ClF3N3O2 — CID 90441327
methyl 4-amino-3-chloro-6-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxylate (PubChem CID 90441327) has the molecular formula C13H9ClF3N3O2 and a molecular weight of 331.68 g/mol. Its IUPAC name is methyl 4-amino-3-chloro-6-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxylate.
| Compound Name | methyl 4-amino-3-chloro-6-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 90441327 |
| Molecular Formula | C13H9ClF3N3O2 |
| Molecular Weight | 331.68 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | methyl 4-amino-3-chloro-6-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(C(F)(F)F)nc2)cc(N)c1Cl |
| InChI | InChI=1S/C13H9ClF3N3O2/c1-22-12(21)11-10(14)7(18)4-8(20-11)6-2-3-9(19-5-6)13(15,16)17/h2-5H,1H3,(H2,18,20) |
| InChIKey | VPKDUQQJGTXYNY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.68 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |