About methyl 4-amino-3,5-dichloro-6-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxylate
methyl 4-amino-3,5-dichloro-6-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxylate (PubChem CID 90441365) has the molecular formula C13H8Cl2F3N3O2
and a molecular weight of 366.13 g/mol. Its IUPAC name is methyl 4-amino-3,5-dichloro-6-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-amino-3,5-dichloro-6-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxylate |
| PubChem CID | 90441365 |
| Molecular Formula | C13H8Cl2F3N3O2 |
| Molecular Weight | 366.13 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | methyl 4-amino-3,5-dichloro-6-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(C(F)(F)F)nc2)c(Cl)c(N)c1Cl |
| InChI | InChI=1S/C13H8Cl2F3N3O2/c1-23-12(22)11-8(15)9(19)7(14)10(21-11)5-2-3-6(20-4-5)13(16,17)18/h2-4H,1H3,(H2,19,21) |
| InChIKey | GJKAJZFMFVKXIE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.13 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-amino-3,5-dichloro-6-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-amino-3,5-dichloro-6-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxylate?
The IUPAC name of methyl 4-amino-3,5-dichloro-6-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxylate (CID 90441365) is methyl 4-amino-3,5-dichloro-6-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxylate.
What is the SMILES notation for methyl 4-amino-3,5-dichloro-6-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxylate?
The canonical SMILES for methyl 4-amino-3,5-dichloro-6-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxylate is COC(=O)c1nc(-c2ccc(C(F)(F)F)nc2)c(Cl)c(N)c1Cl.
What is the InChIKey of methyl 4-amino-3,5-dichloro-6-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxylate?
The InChIKey is GJKAJZFMFVKXIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Cl2F3N3O2/c1-23-12(22)11-8(15)9(19)7(14)10(21-11)5-2-3-6(20-4-5)13(16,17)18/h2-4H,1H3,(H2,19,21).
What are the key properties of methyl 4-amino-3,5-dichloro-6-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxylate?
methyl 4-amino-3,5-dichloro-6-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxylate has a molecular weight of 366.13 g/mol, XLogP of 3.84, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-3,5-dichloro-6-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxylate is sourced from PubChem (CID 90441365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).