C8H19N3O2S — CID 90441717
2-[[(S)-tert-butylsulfinyl]amino]-3,3,3-trideuterio-N'-hydroxy-2-(trideuteriomethyl)propanimidamide (PubChem CID 90441717) has the molecular formula C8H19N3O2S and a molecular weight of 227.36 g/mol. Its IUPAC name is 2-[[(S)-tert-butylsulfinyl]amino]-3,3,3-trideuterio-N'-hydroxy-2-(trideuteriomethyl)propanimidamide.
| Compound Name | 2-[[(S)-tert-butylsulfinyl]amino]-3,3,3-trideuterio-N'-hydroxy-2-(trideuteriomethyl)propanimidamide |
|---|---|
| PubChem CID | 90441717 |
| Molecular Formula | C8H19N3O2S |
| Molecular Weight | 227.36 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 2-[[(S)-tert-butylsulfinyl]amino]-3,3,3-trideuterio-N'-hydroxy-2-(trideuteriomethyl)propanimidamide |
| SMILES | [2H]C([2H])([2H])C(N[S@@](=O)C(C)(C)C)(/C(N)=N/O)C([2H])([2H])[2H] |
| InChI | InChI=1S/C8H19N3O2S/c1-7(2,3)14(13)11-8(4,5)6(9)10-12/h11-12H,1-5H3,(H2,9,10)/t14-/m0/s1/i4D3,5D3 |
| InChIKey | GDLPSAVARFDMCG-VVCWSJISSA-N |
| XLogP | 0.56 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.36 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|