C18H23N3O — CID 90441925
N-[4-[(2E,4E)-5-ethoxyhepta-2,4,6-trienyl]phenyl]-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 90441925) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[4-[(2E,4E)-5-ethoxyhepta-2,4,6-trienyl]phenyl]-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | N-[4-[(2E,4E)-5-ethoxyhepta-2,4,6-trienyl]phenyl]-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 90441925 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | N-[4-[(2E,4E)-5-ethoxyhepta-2,4,6-trienyl]phenyl]-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | C=C/C(=C\C=C\Cc1ccc(NC2=NCCN2)cc1)OCC |
| InChI | InChI=1S/C18H23N3O/c1-3-17(22-4-2)8-6-5-7-15-9-11-16(12-10-15)21-18-19-13-14-20-18/h3,5-6,8-12H,1,4,7,13-14H2,2H3,(H2,19,20,21)/b6-5+,17-8+ |
| InChIKey | QFCXZZIDLMAQDY-KRWGHNRWSA-N |
| XLogP | 3.26 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|