C26H42N6O8 — CID 90442034
2-methoxyethyl 2-[4-[3,5-bis(6-isocyanatohexyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]butylamino]acetate (PubChem CID 90442034) has the molecular formula C26H42N6O8 and a molecular weight of 566.66 g/mol. Its IUPAC name is 2-methoxyethyl 2-[4-[3,5-bis(6-isocyanatohexyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]butylamino]acetate.
| Compound Name | 2-methoxyethyl 2-[4-[3,5-bis(6-isocyanatohexyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]butylamino]acetate |
|---|---|
| PubChem CID | 90442034 |
| Molecular Formula | C26H42N6O8 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.31 |
| IUPAC Name | 2-methoxyethyl 2-[4-[3,5-bis(6-isocyanatohexyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]butylamino]acetate |
| SMILES | COCCOC(=O)CNCCCCn1c(=O)n(CCCCCCN=C=O)c(=O)n(CCCCCCN=C=O)c1=O |
| InChI | InChI=1S/C26H42N6O8/c1-39-18-19-40-23(35)20-27-12-8-11-17-32-25(37)30(15-9-4-2-6-13-28-21-33)24(36)31(26(32)38)16-10-5-3-7-14-29-22-34/h27H,2-20H2,1H3 |
| InChIKey | MHWXEQQRGCJKIE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 172.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|