About (3-chloro-5-phenyl-1,2-thiazol-4-yl) formate
(3-chloro-5-phenyl-1,2-thiazol-4-yl) formate (PubChem CID 90442054) has the molecular formula C10H6ClNO2S
and a molecular weight of 239.68 g/mol. Its IUPAC name is (3-chloro-5-phenyl-1,2-thiazol-4-yl) formate.
Molecular Properties
| Compound Name | (3-chloro-5-phenyl-1,2-thiazol-4-yl) formate |
| PubChem CID | 90442054 |
| Molecular Formula | C10H6ClNO2S |
| Molecular Weight | 239.68 g/mol |
| Exact Mass | 238.98 |
| IUPAC Name | (3-chloro-5-phenyl-1,2-thiazol-4-yl) formate |
| SMILES | O=COc1c(Cl)nsc1-c1ccccc1 |
| InChI | InChI=1S/C10H6ClNO2S/c11-10-8(14-6-13)9(15-12-10)7-4-2-1-3-5-7/h1-6H |
| InChIKey | UPEMWFVEPVJBRE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.68 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3-chloro-5-phenyl-1,2-thiazol-4-yl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chloro-5-phenyl-1,2-thiazol-4-yl) formate?
The IUPAC name of (3-chloro-5-phenyl-1,2-thiazol-4-yl) formate (CID 90442054) is (3-chloro-5-phenyl-1,2-thiazol-4-yl) formate.
What is the SMILES notation for (3-chloro-5-phenyl-1,2-thiazol-4-yl) formate?
The canonical SMILES for (3-chloro-5-phenyl-1,2-thiazol-4-yl) formate is O=COc1c(Cl)nsc1-c1ccccc1.
What is the InChIKey of (3-chloro-5-phenyl-1,2-thiazol-4-yl) formate?
The InChIKey is UPEMWFVEPVJBRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6ClNO2S/c11-10-8(14-6-13)9(15-12-10)7-4-2-1-3-5-7/h1-6H.
What are the key properties of (3-chloro-5-phenyl-1,2-thiazol-4-yl) formate?
(3-chloro-5-phenyl-1,2-thiazol-4-yl) formate has a molecular weight of 239.68 g/mol, XLogP of 3.00, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chloro-5-phenyl-1,2-thiazol-4-yl) formate is sourced from PubChem (CID 90442054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).