C49H58N4 — CID 90442089
4-[4-[1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-4-yl]phenyl]-3-[(2Z,4Z)-2,4,6-trimethylhepta-2,4,6-trienyl]-1-(2,4,6-trimethylphenyl)-2H-imidazole (PubChem CID 90442089) has the molecular formula C49H58N4 and a molecular weight of 703.03 g/mol. Its IUPAC name is 4-[4-[1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-4-yl]phenyl]-3-[(2Z,4Z)-2,4,6-trimethylhepta-2,4,6-trienyl]-1-(2,4,6-trimethylphenyl)-2H-imidazole.
| Compound Name | 4-[4-[1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-4-yl]phenyl]-3-[(2Z,4Z)-2,4,6-trimethylhepta-2,4,6-trienyl]-1-(2,4,6-trimethylphenyl)-2H-imidazole |
|---|---|
| PubChem CID | 90442089 |
| Molecular Formula | C49H58N4 |
| Molecular Weight | 703.03 g/mol |
| Exact Mass | 702.47 |
| IUPAC Name | 4-[4-[1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-4-yl]phenyl]-3-[(2Z,4Z)-2,4,6-trimethylhepta-2,4,6-trienyl]-1-(2,4,6-trimethylphenyl)-2H-imidazole |
| SMILES | C=C(C)/C=C(C)\C=C(\C)CN1CN(c2c(C)cc(C)cc2C)C=C1c1ccc(C2=CN(c3c(C)cc(C)cc3C)CN2c2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C49H58N4/c1-31(2)18-32(3)19-36(7)26-50-29-51(47-37(8)20-33(4)21-38(47)9)27-45(50)43-14-16-44(17-15-43)46-28-52(48-39(10)22-34(5)23-40(48)11)30-53(46)49-41(12)24-35(6)25-42(49)13/h14-25,27-28H,1,26,29-30H2,2-13H3/b32-18-,36-19- |
| InChIKey | FOKYIGIYLQAWSS-BJEIFYEESA-N |
| XLogP | 12.29 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.03 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|