About 2,3-di(propan-2-yl)pyrazino[2,3-d]pyridazine
2,3-di(propan-2-yl)pyrazino[2,3-d]pyridazine (PubChem CID 90442279) has the molecular formula C12H16N4
and a molecular weight of 216.29 g/mol. Its IUPAC name is 2,3-di(propan-2-yl)pyrazino[2,3-d]pyridazine.
Molecular Properties
| Compound Name | 2,3-di(propan-2-yl)pyrazino[2,3-d]pyridazine |
| PubChem CID | 90442279 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 2,3-di(propan-2-yl)pyrazino[2,3-d]pyridazine |
| SMILES | CC(C)c1nc2cnncc2nc1C(C)C |
| InChI | InChI=1S/C12H16N4/c1-7(2)11-12(8(3)4)16-10-6-14-13-5-9(10)15-11/h5-8H,1-4H3 |
| InChIKey | AJAGCZXYZSJQIM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-di(propan-2-yl)pyrazino[2,3-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-di(propan-2-yl)pyrazino[2,3-d]pyridazine?
The IUPAC name of 2,3-di(propan-2-yl)pyrazino[2,3-d]pyridazine (CID 90442279) is 2,3-di(propan-2-yl)pyrazino[2,3-d]pyridazine.
What is the SMILES notation for 2,3-di(propan-2-yl)pyrazino[2,3-d]pyridazine?
The canonical SMILES for 2,3-di(propan-2-yl)pyrazino[2,3-d]pyridazine is CC(C)c1nc2cnncc2nc1C(C)C.
What is the InChIKey of 2,3-di(propan-2-yl)pyrazino[2,3-d]pyridazine?
The InChIKey is AJAGCZXYZSJQIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4/c1-7(2)11-12(8(3)4)16-10-6-14-13-5-9(10)15-11/h5-8H,1-4H3.
What are the key properties of 2,3-di(propan-2-yl)pyrazino[2,3-d]pyridazine?
2,3-di(propan-2-yl)pyrazino[2,3-d]pyridazine has a molecular weight of 216.29 g/mol, XLogP of 2.67, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-di(propan-2-yl)pyrazino[2,3-d]pyridazine is sourced from PubChem (CID 90442279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).