C11H18O — CID 90442322
(1R,2S,3R,5R)-3-pent-4-enylbicyclo[3.1.0]hexan-2-ol (PubChem CID 90442322) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-pent-4-enylbicyclo[3.1.0]hexan-2-ol.
| Compound Name | (1R,2S,3R,5R)-3-pent-4-enylbicyclo[3.1.0]hexan-2-ol |
|---|---|
| PubChem CID | 90442322 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (1R,2S,3R,5R)-3-pent-4-enylbicyclo[3.1.0]hexan-2-ol |
| SMILES | C=CCCC[C@@H]1C[C@H]2C[C@H]2[C@H]1O |
| InChI | InChI=1S/C11H18O/c1-2-3-4-5-8-6-9-7-10(9)11(8)12/h2,8-12H,1,3-7H2/t8-,9+,10-,11+/m1/s1 |
| InChIKey | UOTFKMHGRBHGMA-YTWAJWBKSA-N |
| XLogP | 2.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|