C18H17F4N3O4 — CID 90442335
methyl (2S,4R)-4-[7-(difluoromethoxy)-3-(1,1-difluoroprop-2-enyl)quinoxalin-2-yl]oxypyrrolidine-2-carboxylate (PubChem CID 90442335) has the molecular formula C18H17F4N3O4 and a molecular weight of 415.34 g/mol. Its IUPAC name is methyl (2S,4R)-4-[7-(difluoromethoxy)-3-(1,1-difluoroprop-2-enyl)quinoxalin-2-yl]oxypyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-4-[7-(difluoromethoxy)-3-(1,1-difluoroprop-2-enyl)quinoxalin-2-yl]oxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 90442335 |
| Molecular Formula | C18H17F4N3O4 |
| Molecular Weight | 415.34 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | methyl (2S,4R)-4-[7-(difluoromethoxy)-3-(1,1-difluoroprop-2-enyl)quinoxalin-2-yl]oxypyrrolidine-2-carboxylate |
| SMILES | C=CC(F)(F)c1nc2ccc(OC(F)F)cc2nc1O[C@H]1CN[C@H](C(=O)OC)C1 |
| InChI | InChI=1S/C18H17F4N3O4/c1-3-18(21,22)14-15(28-10-7-13(23-8-10)16(26)27-2)25-12-6-9(29-17(19)20)4-5-11(12)24-14/h3-6,10,13,17,23H,1,7-8H2,2H3/t10-,13+/m1/s1 |
| InChIKey | KKHIMQJNEFLOIR-MFKMUULPSA-N |
| XLogP | 2.79 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|