C17H17F2N3O3 — CID 90442337
methyl (2S,4R)-4-[3-(1,1-difluoroprop-2-enyl)quinoxalin-2-yl]oxypyrrolidine-2-carboxylate (PubChem CID 90442337) has the molecular formula C17H17F2N3O3 and a molecular weight of 349.34 g/mol. Its IUPAC name is methyl (2S,4R)-4-[3-(1,1-difluoroprop-2-enyl)quinoxalin-2-yl]oxypyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-4-[3-(1,1-difluoroprop-2-enyl)quinoxalin-2-yl]oxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 90442337 |
| Molecular Formula | C17H17F2N3O3 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | methyl (2S,4R)-4-[3-(1,1-difluoroprop-2-enyl)quinoxalin-2-yl]oxypyrrolidine-2-carboxylate |
| SMILES | C=CC(F)(F)c1nc2ccccc2nc1O[C@H]1CN[C@H](C(=O)OC)C1 |
| InChI | InChI=1S/C17H17F2N3O3/c1-3-17(18,19)14-15(22-12-7-5-4-6-11(12)21-14)25-10-8-13(20-9-10)16(23)24-2/h3-7,10,13,20H,1,8-9H2,2H3/t10-,13+/m1/s1 |
| InChIKey | JXDLDMRPSZYOKT-MFKMUULPSA-N |
| XLogP | 2.19 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|