C29H35N3 — CID 90442397
N-(2,3,4,5,6-pentamethylphenyl)-1-[6-[(2,3,4,5,6-pentamethylphenyl)iminomethyl]-2-pyridinyl]methanimine (PubChem CID 90442397) has the molecular formula C29H35N3 and a molecular weight of 425.62 g/mol. Its IUPAC name is N-(2,3,4,5,6-pentamethylphenyl)-1-[6-[(2,3,4,5,6-pentamethylphenyl)iminomethyl]-2-pyridinyl]methanimine.
| Compound Name | N-(2,3,4,5,6-pentamethylphenyl)-1-[6-[(2,3,4,5,6-pentamethylphenyl)iminomethyl]-2-pyridinyl]methanimine |
|---|---|
| PubChem CID | 90442397 |
| Molecular Formula | C29H35N3 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | N-(2,3,4,5,6-pentamethylphenyl)-1-[6-[(2,3,4,5,6-pentamethylphenyl)iminomethyl]-2-pyridinyl]methanimine |
| SMILES | Cc1c(C)c(C)c(/N=C/c2cccc(/C=N/c3c(C)c(C)c(C)c(C)c3C)n2)c(C)c1C |
| InChI | InChI=1S/C29H35N3/c1-16-18(3)22(7)28(23(8)19(16)4)30-14-26-12-11-13-27(32-26)15-31-29-24(9)20(5)17(2)21(6)25(29)10/h11-15H,1-10H3/b30-14+,31-15+ |
| InChIKey | IUUUQFCUGDGTJE-WCZMLVOGSA-N |
| XLogP | 7.67 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|