C21H20ClN5O2 — CID 90442695
(2-chloro-3-methylphenyl)-[(1S,8R)-5-(6-methyl-2-pyridinyl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone (PubChem CID 90442695) has the molecular formula C21H20ClN5O2 and a molecular weight of 409.88 g/mol. Its IUPAC name is (2-chloro-3-methylphenyl)-[(1S,8R)-5-(6-methyl-2-pyridinyl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone.
| Compound Name | (2-chloro-3-methylphenyl)-[(1S,8R)-5-(6-methyl-2-pyridinyl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone |
|---|---|
| PubChem CID | 90442695 |
| Molecular Formula | C21H20ClN5O2 |
| Molecular Weight | 409.88 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | (2-chloro-3-methylphenyl)-[(1S,8R)-5-(6-methyl-2-pyridinyl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone |
| SMILES | Cc1cccc(-c2nnc3n2C[C@@H]2COC[C@H]3N2C(=O)c2cccc(C)c2Cl)n1 |
| InChI | InChI=1S/C21H20ClN5O2/c1-12-5-3-7-15(18(12)22)21(28)27-14-9-26-19(16-8-4-6-13(2)23-16)24-25-20(26)17(27)11-29-10-14/h3-8,14,17H,9-11H2,1-2H3/t14-,17-/m1/s1 |
| InChIKey | LCENXRNNIYRXAF-RHSMWYFYSA-N |
| XLogP | 3.21 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.88 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |