C33H31F3N6O3S — CID 90442818
(1Z)-1-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(Z)-4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]but-3-enyl]urea (PubChem CID 90442818) has the molecular formula C33H31F3N6O3S and a molecular weight of 648.71 g/mol. Its IUPAC name is (1Z)-1-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(Z)-4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]but-3-enyl]urea.
| Compound Name | (1Z)-1-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(Z)-4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]but-3-enyl]urea |
|---|---|
| PubChem CID | 90442818 |
| Molecular Formula | C33H31F3N6O3S |
| Molecular Weight | 648.71 g/mol |
| Exact Mass | 648.21 |
| IUPAC Name | (1Z)-1-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(Z)-4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]but-3-enyl]urea |
| SMILES | Cc1ccc(C(C)C)c(N2C(=O)CS/C2=N\C(=O)NCC/C=C\c2cccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)c2)c1 |
| InChI | InChI=1S/C33H31F3N6O3S/c1-21(2)27-15-10-22(3)17-28(27)42-29(43)19-46-32(42)39-31(44)37-16-5-4-7-23-8-6-9-24(18-23)30-38-20-41(40-30)25-11-13-26(14-12-25)45-33(34,35)36/h4,6-15,17-18,20-21H,5,16,19H2,1-3H3,(H,37,44)/b7-4-,39-32- |
| InChIKey | MSKNFQBASFYQMP-PBJQWWEFSA-N |
| XLogP | 7.51 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.71 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|