C21H22FN3O3 — CID 90443342
2-[5-[(3E,5Z)-7-(cyclopropylmethoxy)-3-fluorohepta-1,3,5-trien-2-yl]-1-methylimidazol-4-yl]pyridine-4-carboxylic acid (PubChem CID 90443342) has the molecular formula C21H22FN3O3 and a molecular weight of 383.42 g/mol. Its IUPAC name is 2-[5-[(3E,5Z)-7-(cyclopropylmethoxy)-3-fluorohepta-1,3,5-trien-2-yl]-1-methylimidazol-4-yl]pyridine-4-carboxylic acid.
| Compound Name | 2-[5-[(3E,5Z)-7-(cyclopropylmethoxy)-3-fluorohepta-1,3,5-trien-2-yl]-1-methylimidazol-4-yl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 90443342 |
| Molecular Formula | C21H22FN3O3 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 2-[5-[(3E,5Z)-7-(cyclopropylmethoxy)-3-fluorohepta-1,3,5-trien-2-yl]-1-methylimidazol-4-yl]pyridine-4-carboxylic acid |
| SMILES | C=C(/C(F)=C\C=C/COCC1CC1)c1c(-c2cc(C(=O)O)ccn2)ncn1C |
| InChI | InChI=1S/C21H22FN3O3/c1-14(17(22)5-3-4-10-28-12-15-6-7-15)20-19(24-13-25(20)2)18-11-16(21(26)27)8-9-23-18/h3-5,8-9,11,13,15H,1,6-7,10,12H2,2H3,(H,26,27)/b4-3-,17-5+ |
| InChIKey | NDEULISSMUMRSY-XCMKXHSXSA-N |
| XLogP | 4.03 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|