C31H34ClF3N4O6 — CID 90443416
7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-8-[3-[3-(trifluoromethoxy)phenyl]propoxy]purine-2,6-dione (PubChem CID 90443416) has the molecular formula C31H34ClF3N4O6 and a molecular weight of 651.08 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-8-[3-[3-(trifluoromethoxy)phenyl]propoxy]purine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-8-[3-[3-(trifluoromethoxy)phenyl]propoxy]purine-2,6-dione |
|---|---|
| PubChem CID | 90443416 |
| Molecular Formula | C31H34ClF3N4O6 |
| Molecular Weight | 651.08 g/mol |
| Exact Mass | 650.21 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-8-[3-[3-(trifluoromethoxy)phenyl]propoxy]purine-2,6-dione |
| SMILES | Cn1c(=O)n(CCCOC2CCCCO2)c(=O)c2c1nc(OCCCc1cccc(OC(F)(F)F)c1)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H34ClF3N4O6/c1-37-27-26(28(40)38(30(37)41)15-6-18-43-25-10-2-3-16-42-25)39(20-22-11-13-23(32)14-12-22)29(36-27)44-17-5-8-21-7-4-9-24(19-21)45-31(33,34)35/h4,7,9,11-14,19,25H,2-3,5-6,8,10,15-18,20H2,1H3 |
| InChIKey | ZAIVGVLLWSIOJA-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 98.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.08 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|