About 2,5-diethyl-4-methyl-2,3-dihydrofuran
2,5-diethyl-4-methyl-2,3-dihydrofuran (PubChem CID 90443455) has the molecular formula C9H16O
and a molecular weight of 140.23 g/mol. Its IUPAC name is 2,5-diethyl-4-methyl-2,3-dihydrofuran.
Molecular Properties
| Compound Name | 2,5-diethyl-4-methyl-2,3-dihydrofuran |
| PubChem CID | 90443455 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | 2,5-diethyl-4-methyl-2,3-dihydrofuran |
| SMILES | CCC1=C(C)CC(CC)O1 |
| InChI | InChI=1S/C9H16O/c1-4-8-6-7(3)9(5-2)10-8/h8H,4-6H2,1-3H3 |
| InChIKey | RIEFRTHVTJGMQJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,5-diethyl-4-methyl-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diethyl-4-methyl-2,3-dihydrofuran?
The IUPAC name of 2,5-diethyl-4-methyl-2,3-dihydrofuran (CID 90443455) is 2,5-diethyl-4-methyl-2,3-dihydrofuran.
What is the SMILES notation for 2,5-diethyl-4-methyl-2,3-dihydrofuran?
The canonical SMILES for 2,5-diethyl-4-methyl-2,3-dihydrofuran is CCC1=C(C)CC(CC)O1.
What is the InChIKey of 2,5-diethyl-4-methyl-2,3-dihydrofuran?
The InChIKey is RIEFRTHVTJGMQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O/c1-4-8-6-7(3)9(5-2)10-8/h8H,4-6H2,1-3H3.
What are the key properties of 2,5-diethyl-4-methyl-2,3-dihydrofuran?
2,5-diethyl-4-methyl-2,3-dihydrofuran has a molecular weight of 140.23 g/mol, XLogP of 2.87, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diethyl-4-methyl-2,3-dihydrofuran is sourced from PubChem (CID 90443455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).