C19H32O8 — CID 90443509
(3aS,6R,6aS)-3a-(2-butoxyethoxymethyl)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one (PubChem CID 90443509) has the molecular formula C19H32O8 and a molecular weight of 388.46 g/mol. Its IUPAC name is (3aS,6R,6aS)-3a-(2-butoxyethoxymethyl)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one.
| Compound Name | (3aS,6R,6aS)-3a-(2-butoxyethoxymethyl)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 90443509 |
| Molecular Formula | C19H32O8 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | (3aS,6R,6aS)-3a-(2-butoxyethoxymethyl)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one |
| SMILES | CCCCOCCOC[C@]12OC(C)(C)O[C@H]1[C@@H]([C@H]1COC(C)(C)O1)OC2=O |
| InChI | InChI=1S/C19H32O8/c1-6-7-8-21-9-10-22-12-19-15(26-18(4,5)27-19)14(24-16(19)20)13-11-23-17(2,3)25-13/h13-15H,6-12H2,1-5H3/t13-,14-,15+,19+/m1/s1 |
| InChIKey | KBOWBLFGYFXFFF-CUYVQJCZSA-N |
| XLogP | 1.79 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|