C32H46FNO6 — CID 90443530
N-methyl-3-[4-[(2R,3S,4S,5S,6S)-3,4,5-tributoxy-6-(fluoromethyl)oxan-2-yl]oxyphenyl]benzamide (PubChem CID 90443530) has the molecular formula C32H46FNO6 and a molecular weight of 559.72 g/mol. Its IUPAC name is N-methyl-3-[4-[(2R,3S,4S,5S,6S)-3,4,5-tributoxy-6-(fluoromethyl)oxan-2-yl]oxyphenyl]benzamide.
| Compound Name | N-methyl-3-[4-[(2R,3S,4S,5S,6S)-3,4,5-tributoxy-6-(fluoromethyl)oxan-2-yl]oxyphenyl]benzamide |
|---|---|
| PubChem CID | 90443530 |
| Molecular Formula | C32H46FNO6 |
| Molecular Weight | 559.72 g/mol |
| Exact Mass | 559.33 |
| IUPAC Name | N-methyl-3-[4-[(2R,3S,4S,5S,6S)-3,4,5-tributoxy-6-(fluoromethyl)oxan-2-yl]oxyphenyl]benzamide |
| SMILES | CCCCO[C@@H]1[C@H](OCCCC)[C@@H](Oc2ccc(-c3cccc(C(=O)NC)c3)cc2)O[C@H](CF)[C@H]1OCCCC |
| InChI | InChI=1S/C32H46FNO6/c1-5-8-18-36-28-27(22-33)40-32(30(38-20-10-7-3)29(28)37-19-9-6-2)39-26-16-14-23(15-17-26)24-12-11-13-25(21-24)31(35)34-4/h11-17,21,27-30,32H,5-10,18-20,22H2,1-4H3,(H,34,35)/t27-,28-,29+,30+,32+/m1/s1 |
| InChIKey | GEICGTBPHCEBNL-SGFBLBLDSA-N |
| XLogP | 6.34 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.72 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|