C23H27FO4S — CID 90443541
(4aR,6R,7S,8S,8aR)-7-butoxy-8-fluoro-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 90443541) has the molecular formula C23H27FO4S and a molecular weight of 418.53 g/mol. Its IUPAC name is (4aR,6R,7S,8S,8aR)-7-butoxy-8-fluoro-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aR,6R,7S,8S,8aR)-7-butoxy-8-fluoro-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 90443541 |
| Molecular Formula | C23H27FO4S |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (4aR,6R,7S,8S,8aR)-7-butoxy-8-fluoro-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CCCCO[C@H]1[C@@H](F)[C@@H]2OC(c3ccccc3)OC[C@H]2O[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C23H27FO4S/c1-2-3-14-25-21-19(24)20-18(27-23(21)29-17-12-8-5-9-13-17)15-26-22(28-20)16-10-6-4-7-11-16/h4-13,18-23H,2-3,14-15H2,1H3/t18-,19+,20-,21+,22?,23-/m1/s1 |
| InChIKey | ZOXPPPCQRVDGAB-HJRJFAHRSA-N |
| XLogP | 5.14 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|