C17H28O7 — CID 90443551
(3aS,6R,6aS)-3a-(butoxymethyl)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one (PubChem CID 90443551) has the molecular formula C17H28O7 and a molecular weight of 344.40 g/mol. Its IUPAC name is (3aS,6R,6aS)-3a-(butoxymethyl)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one.
| Compound Name | (3aS,6R,6aS)-3a-(butoxymethyl)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 90443551 |
| Molecular Formula | C17H28O7 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (3aS,6R,6aS)-3a-(butoxymethyl)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one |
| SMILES | CCCCOC[C@]12OC(C)(C)O[C@H]1[C@@H]([C@H]1COC(C)(C)O1)OC2=O |
| InChI | InChI=1S/C17H28O7/c1-6-7-8-19-10-17-13(23-16(4,5)24-17)12(21-14(17)18)11-9-20-15(2,3)22-11/h11-13H,6-10H2,1-5H3/t11-,12-,13+,17+/m1/s1 |
| InChIKey | GAAICLPHJMUQNW-FJZAXULXSA-N |
| XLogP | 1.77 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|