C31H39NO2S — CID 90443795
1-methoxy-2,4-dimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]phenothiazin-3-one (PubChem CID 90443795) has the molecular formula C31H39NO2S and a molecular weight of 489.73 g/mol. Its IUPAC name is 1-methoxy-2,4-dimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]phenothiazin-3-one.
| Compound Name | 1-methoxy-2,4-dimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]phenothiazin-3-one |
|---|---|
| PubChem CID | 90443795 |
| Molecular Formula | C31H39NO2S |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | 1-methoxy-2,4-dimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]phenothiazin-3-one |
| SMILES | COc1c2nc3cc(CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)ccc3sc-2c(C)c(=O)c1C |
| InChI | InChI=1S/C31H39NO2S/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-16-25-17-18-27-26(19-25)32-28-30(34-7)23(5)29(33)24(6)31(28)35-27/h11,13,15,17-19H,8-10,12,14,16H2,1-7H3/b21-13+,22-15+ |
| InChIKey | HDFUDBNCTWDJFE-NTZRDTQNSA-N |
| XLogP | 8.74 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|