About propan-2-yl 2-[1-[(3R,4R)-4-cyclopropylpyrrolidin-3-yl]-6-fluoroindazol-3-yl]acetate
propan-2-yl 2-[1-[(3R,4R)-4-cyclopropylpyrrolidin-3-yl]-6-fluoroindazol-3-yl]acetate (PubChem CID 90444436) has the molecular formula C19H24FN3O2
and a molecular weight of 345.42 g/mol. Its IUPAC name is propan-2-yl 2-[1-[(3R,4R)-4-cyclopropylpyrrolidin-3-yl]-6-fluoroindazol-3-yl]acetate.
Molecular Properties
| Compound Name | propan-2-yl 2-[1-[(3R,4R)-4-cyclopropylpyrrolidin-3-yl]-6-fluoroindazol-3-yl]acetate |
| PubChem CID | 90444436 |
| Molecular Formula | C19H24FN3O2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | propan-2-yl 2-[1-[(3R,4R)-4-cyclopropylpyrrolidin-3-yl]-6-fluoroindazol-3-yl]acetate |
| SMILES | CC(C)OC(=O)Cc1nn([C@H]2CNC[C@H]2C2CC2)c2cc(F)ccc12 |
| InChI | InChI=1S/C19H24FN3O2/c1-11(2)25-19(24)8-16-14-6-5-13(20)7-17(14)23(22-16)18-10-21-9-15(18)12-3-4-12/h5-7,11-12,15,18,21H,3-4,8-10H2,1-2H3/t15-,18-/m0/s1 |
| InChIKey | BOBYWNPDHGDDLH-YJBOKZPZSA-N |
| XLogP | 2.84 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propan-2-yl 2-[1-[(3R,4R)-4-cyclopropylpyrrolidin-3-yl]-6-fluoroindazol-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-[1-[(3R,4R)-4-cyclopropylpyrrolidin-3-yl]-6-fluoroindazol-3-yl]acetate?
The IUPAC name of propan-2-yl 2-[1-[(3R,4R)-4-cyclopropylpyrrolidin-3-yl]-6-fluoroindazol-3-yl]acetate (CID 90444436) is propan-2-yl 2-[1-[(3R,4R)-4-cyclopropylpyrrolidin-3-yl]-6-fluoroindazol-3-yl]acetate.
What is the SMILES notation for propan-2-yl 2-[1-[(3R,4R)-4-cyclopropylpyrrolidin-3-yl]-6-fluoroindazol-3-yl]acetate?
The canonical SMILES for propan-2-yl 2-[1-[(3R,4R)-4-cyclopropylpyrrolidin-3-yl]-6-fluoroindazol-3-yl]acetate is CC(C)OC(=O)Cc1nn([C@H]2CNC[C@H]2C2CC2)c2cc(F)ccc12.
What is the InChIKey of propan-2-yl 2-[1-[(3R,4R)-4-cyclopropylpyrrolidin-3-yl]-6-fluoroindazol-3-yl]acetate?
The InChIKey is BOBYWNPDHGDDLH-YJBOKZPZSA-N. The full InChI is InChI=1S/C19H24FN3O2/c1-11(2)25-19(24)8-16-14-6-5-13(20)7-17(14)23(22-16)18-10-21-9-15(18)12-3-4-12/h5-7,11-12,15,18,21H,3-4,8-10H2,1-2H3/t15-,18-/m0/s1.
What are the key properties of propan-2-yl 2-[1-[(3R,4R)-4-cyclopropylpyrrolidin-3-yl]-6-fluoroindazol-3-yl]acetate?
propan-2-yl 2-[1-[(3R,4R)-4-cyclopropylpyrrolidin-3-yl]-6-fluoroindazol-3-yl]acetate has a molecular weight of 345.42 g/mol, XLogP of 2.84, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-[1-[(3R,4R)-4-cyclopropylpyrrolidin-3-yl]-6-fluoroindazol-3-yl]acetate is sourced from PubChem (CID 90444436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).