C9H15NO — CID 90444788
(1E,3Z)-4-[2-(methylamino)ethyl]hexa-1,3,5-trien-1-ol (PubChem CID 90444788) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (1E,3Z)-4-[2-(methylamino)ethyl]hexa-1,3,5-trien-1-ol.
| Compound Name | (1E,3Z)-4-[2-(methylamino)ethyl]hexa-1,3,5-trien-1-ol |
|---|---|
| PubChem CID | 90444788 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (1E,3Z)-4-[2-(methylamino)ethyl]hexa-1,3,5-trien-1-ol |
| SMILES | C=C/C(=C\C=C\O)CCNC |
| InChI | InChI=1S/C9H15NO/c1-3-9(5-4-8-11)6-7-10-2/h3-5,8,10-11H,1,6-7H2,2H3/b8-4+,9-5+ |
| InChIKey | WHVSPCHRWUMTGK-KBXRYBNXSA-N |
| XLogP | 1.78 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|