About (4Z,6E)-6-methoxy-N-methylocta-4,6-dien-1-amine
(4Z,6E)-6-methoxy-N-methylocta-4,6-dien-1-amine (PubChem CID 90444789) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is (4Z,6E)-6-methoxy-N-methylocta-4,6-dien-1-amine.
Molecular Properties
| Compound Name | (4Z,6E)-6-methoxy-N-methylocta-4,6-dien-1-amine |
| PubChem CID | 90444789 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (4Z,6E)-6-methoxy-N-methylocta-4,6-dien-1-amine |
| SMILES | C/C=C(\C=C/CCCNC)OC |
| InChI | InChI=1S/C10H19NO/c1-4-10(12-3)8-6-5-7-9-11-2/h4,6,8,11H,5,7,9H2,1-3H3/b8-6-,10-4+ |
| InChIKey | OPXDRCGTXOYKSO-YCQMGFCGSA-N |
| XLogP | 2.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z,6E)-6-methoxy-N-methylocta-4,6-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z,6E)-6-methoxy-N-methylocta-4,6-dien-1-amine?
The IUPAC name of (4Z,6E)-6-methoxy-N-methylocta-4,6-dien-1-amine (CID 90444789) is (4Z,6E)-6-methoxy-N-methylocta-4,6-dien-1-amine.
What is the SMILES notation for (4Z,6E)-6-methoxy-N-methylocta-4,6-dien-1-amine?
The canonical SMILES for (4Z,6E)-6-methoxy-N-methylocta-4,6-dien-1-amine is C/C=C(\C=C/CCCNC)OC.
What is the InChIKey of (4Z,6E)-6-methoxy-N-methylocta-4,6-dien-1-amine?
The InChIKey is OPXDRCGTXOYKSO-YCQMGFCGSA-N. The full InChI is InChI=1S/C10H19NO/c1-4-10(12-3)8-6-5-7-9-11-2/h4,6,8,11H,5,7,9H2,1-3H3/b8-6-,10-4+.
What are the key properties of (4Z,6E)-6-methoxy-N-methylocta-4,6-dien-1-amine?
(4Z,6E)-6-methoxy-N-methylocta-4,6-dien-1-amine has a molecular weight of 169.27 g/mol, XLogP of 2.09, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z,6E)-6-methoxy-N-methylocta-4,6-dien-1-amine is sourced from PubChem (CID 90444789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).