C17H24ClNO — CID 90444805
3-[[(4Z)-2-(4-chlorocyclohexa-2,4-dien-1-yl)-3-methylidenehepta-4,6-dienyl]amino]propan-1-ol (PubChem CID 90444805) has the molecular formula C17H24ClNO and a molecular weight of 293.84 g/mol. Its IUPAC name is 3-[[(4Z)-2-(4-chlorocyclohexa-2,4-dien-1-yl)-3-methylidenehepta-4,6-dienyl]amino]propan-1-ol.
| Compound Name | 3-[[(4Z)-2-(4-chlorocyclohexa-2,4-dien-1-yl)-3-methylidenehepta-4,6-dienyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 90444805 |
| Molecular Formula | C17H24ClNO |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 3-[[(4Z)-2-(4-chlorocyclohexa-2,4-dien-1-yl)-3-methylidenehepta-4,6-dienyl]amino]propan-1-ol |
| SMILES | C=C/C=C\C(=C)C(CNCCCO)C1C=CC(Cl)=CC1 |
| InChI | InChI=1S/C17H24ClNO/c1-3-4-6-14(2)17(13-19-11-5-12-20)15-7-9-16(18)10-8-15/h3-4,6-7,9-10,15,17,19-20H,1-2,5,8,11-13H2/b6-4- |
| InChIKey | NJYLTAHAZSPFFC-XQRVVYSFSA-N |
| XLogP | 3.57 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|