About 2-N-propylpyrazolo[1,5-a]pyridine-2,3-diamine
2-N-propylpyrazolo[1,5-a]pyridine-2,3-diamine (PubChem CID 90445488) has the molecular formula C10H14N4
and a molecular weight of 190.25 g/mol. Its IUPAC name is 2-N-propylpyrazolo[1,5-a]pyridine-2,3-diamine.
Molecular Properties
| Compound Name | 2-N-propylpyrazolo[1,5-a]pyridine-2,3-diamine |
| PubChem CID | 90445488 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 2-N-propylpyrazolo[1,5-a]pyridine-2,3-diamine |
| SMILES | CCCNc1nn2ccccc2c1N |
| InChI | InChI=1S/C10H14N4/c1-2-6-12-10-9(11)8-5-3-4-7-14(8)13-10/h3-5,7H,2,6,11H2,1H3,(H,12,13) |
| InChIKey | DQWDOIKCUYFRAY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N-propylpyrazolo[1,5-a]pyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-propylpyrazolo[1,5-a]pyridine-2,3-diamine?
The IUPAC name of 2-N-propylpyrazolo[1,5-a]pyridine-2,3-diamine (CID 90445488) is 2-N-propylpyrazolo[1,5-a]pyridine-2,3-diamine.
What is the SMILES notation for 2-N-propylpyrazolo[1,5-a]pyridine-2,3-diamine?
The canonical SMILES for 2-N-propylpyrazolo[1,5-a]pyridine-2,3-diamine is CCCNc1nn2ccccc2c1N.
What is the InChIKey of 2-N-propylpyrazolo[1,5-a]pyridine-2,3-diamine?
The InChIKey is DQWDOIKCUYFRAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4/c1-2-6-12-10-9(11)8-5-3-4-7-14(8)13-10/h3-5,7H,2,6,11H2,1H3,(H,12,13).
What are the key properties of 2-N-propylpyrazolo[1,5-a]pyridine-2,3-diamine?
2-N-propylpyrazolo[1,5-a]pyridine-2,3-diamine has a molecular weight of 190.25 g/mol, XLogP of 1.74, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-propylpyrazolo[1,5-a]pyridine-2,3-diamine is sourced from PubChem (CID 90445488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).