C11H23N2O3P — CID 90445538
tert-butyl N-[2-(4-phosphanylbutanoylamino)ethyl]carbamate (PubChem CID 90445538) has the molecular formula C11H23N2O3P and a molecular weight of 262.29 g/mol. Its IUPAC name is tert-butyl N-[2-(4-phosphanylbutanoylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(4-phosphanylbutanoylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 90445538 |
| Molecular Formula | C11H23N2O3P |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | tert-butyl N-[2-(4-phosphanylbutanoylamino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)CCCP |
| InChI | InChI=1S/C11H23N2O3P/c1-11(2,3)16-10(15)13-7-6-12-9(14)5-4-8-17/h4-8,17H2,1-3H3,(H,12,14)(H,13,15) |
| InChIKey | HNZMLOQGQCUFOB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|