About 5-methyl-6H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one
5-methyl-6H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 90445551) has the molecular formula C6H6N4O
and a molecular weight of 150.14 g/mol. Its IUPAC name is 5-methyl-6H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 5-methyl-6H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| PubChem CID | 90445551 |
| Molecular Formula | C6H6N4O |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 5-methyl-6H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | CC1=Nc2ncnn2C(=O)C1 |
| InChI | InChI=1S/C6H6N4O/c1-4-2-5(11)10-6(9-4)7-3-8-10/h3H,2H2,1H3 |
| InChIKey | YOCXDGBQQYVALU-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methyl-6H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-6H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one?
The IUPAC name of 5-methyl-6H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (CID 90445551) is 5-methyl-6H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
What is the SMILES notation for 5-methyl-6H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one?
The canonical SMILES for 5-methyl-6H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one is CC1=Nc2ncnn2C(=O)C1.
What is the InChIKey of 5-methyl-6H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one?
The InChIKey is YOCXDGBQQYVALU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O/c1-4-2-5(11)10-6(9-4)7-3-8-10/h3H,2H2,1H3.
What are the key properties of 5-methyl-6H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one?
5-methyl-6H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one has a molecular weight of 150.14 g/mol, XLogP of 0.41, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-6H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one is sourced from PubChem (CID 90445551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).