C8H13NS — CID 90445639
6-methyl-2,3,3a,4,5,6-hexahydro-1,3-benzothiazole (PubChem CID 90445639) has the molecular formula C8H13NS and a molecular weight of 155.27 g/mol. Its IUPAC name is 6-methyl-2,3,3a,4,5,6-hexahydro-1,3-benzothiazole.
| Compound Name | 6-methyl-2,3,3a,4,5,6-hexahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 90445639 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 6-methyl-2,3,3a,4,5,6-hexahydro-1,3-benzothiazole |
| SMILES | CC1C=C2SCNC2CC1 |
| InChI | InChI=1S/C8H13NS/c1-6-2-3-7-8(4-6)10-5-9-7/h4,6-7,9H,2-3,5H2,1H3 |
| InChIKey | HCYVSVBUNVEVLZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |